FL5FAAGL0036
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAA Kaempferol (349 pages) : FL5FAAGL 3-Glucoside and related (112 pages) : FL5FAAGL0 Normal (109 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 93098-79-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FAAGL0036.mol |
| Kaempferol 3-sophoroside-7-rhamnoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3- [ 2-O- (beta-D-Glucopyranosyl) -beta-D-glucopyranosyloxy ] -5-hydroxy-7- (alpha-L-rhamnopyranosyloxy) -2- (4-hydroxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C33H40O20 |
| Exact Mass | 756.21129372 |
| Average Mass | 756.6587 |
| SMILES | O(C(O6)C(C(O)C(C(CO)6)O)OC(O5)C(C(O)C(C(CO)5)O)O)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
