FL7AAHGL0004
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=3,5,7,3',4'-Pentahydroxy-5'-methoxyflavylium 3-rhamnosyl-(1->6)-glucoside | |SysName=3,5,7,3',4'-Pentahydroxy-5'-methoxyflavylium 3-rhamnosyl-(1->6)-glucoside | ||
| − | |Common Name=&&Petunidin 3-rutinoside&& | + | |Common Name=&&Petunidin 3-rutinoside&&3,5,7,3',4'-Pentahydroxy-5'-methoxyflavylium 3-rhamnosyl-(1->6)-glucoside&& |
|CAS=39824-84-5 | |CAS=39824-84-5 | ||
|KNApSAcK=C00006727 | |KNApSAcK=C00006727 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 39824-84-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL7AAHGL0004.mol |
| Petunidin 3-rutinoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7,3',4'-Pentahydroxy-5'-methoxyflavylium 3-rhamnosyl-(1->6)-glucoside |
| Common Name |
|
| Symbol | |
| Formula | C28H33O16 |
| Exact Mass | 625.176860008 |
| Average Mass | 625.55202 |
| SMILES | c(c1)(c(O)5)c(cc(O)c5)[o+1]c(c(c4)cc(c(O)c4OC)O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| [show] Species-Flavonoid Relationship Reported |
|---|
