LBF24109SC01
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0131 |
| LipidMaps | LMFA01030092 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF24109SC01.mol |
| Nervonic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | cis-15-Tetracosenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C24H46O2 |
| Exact Mass | 366.349780716 |
| Average Mass | 366.62084 |
| SMILES | C(CCCCC(O)=O)CCCCCCCCC=CCCCCCCCC |
| Physicochemical Information | |
| Melting Point | 42.5-43°C |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in acetone, ethanol and ether <<0092>> <<0210>> <<0290>> <<0503>> <<0504>> <<0506>> |
| Spectral Information | |
| Mass Spectra | (provided by Dr. Takeshi Kasama). |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | Gas liquid chromatogram (provided by Dr. Akiko Horiuchi). |
