LBF20503SC01
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0220 |
| LipidMaps | LMFA01030181 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20503SC01.mol |
| Eicosapentanoic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5, 8, 11, 14, 17-Eicosapentaenoic acid / 5, 8, 11, 14, 17-icosapentaenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C20H30O2 |
| Exact Mass | 302.224580204 |
| Average Mass | 302.451 |
| SMILES | C(CC=CCC=CCC=CCC=CCCCC(O)=O)=CCC |
| Physicochemical Information | |
| Melting Point | -54.4 to -53.8 °C |
| Boiling Point | |
| Density | |
| Optical Rotation | 1.4977 at 23 °C |
| Reflactive Index | |
| Solubility | soluble in heptane and methyl alcohol.<<0265>><<0269>> |
| Spectral Information | |
| Mass Spectra | ""METHYL ESTER:316,300,287,262,247,234,215,201,180,161,152 "" <<6056>> |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | ""METHYL ESTER: |
| Chromatograms | Gas liquid chromatogram  (provided by Dr. Akiko Horiuchi). |
