LBF20406AM33
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR7050 |
| LipidMaps | LMFA08020036 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406AM33.mol |
| |
| Structural Information | |
| Systematic Name | N-isopropyl alpha,alpha-dimethylarachidonoyl amide |
| Common Name | |
| Symbol | |
| Formula | C25H43NO |
| Exact Mass | 373.334465003 |
| Average Mass | 373.61505999999997 |
| SMILES | C(=CCC=CCC=CCC=CCCCCC)CCC(C)(C)C(NC(C)C)=O |
| Physicochemical Information | |
| Melting Point | colorless oil <<7001>> |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | 1H NMR (CDCl3) d5.20-5.50 (m, 9H), 4.04-4.14 (m, lH), 2.76-2.90 (m, 6H), 1.90-2.15 (m, 4H), 1.10-1.60 (series of m, 20H), 0.90 (t, J=6.9Hz, 3H). <<7001>> |
| Chromatograms | |
