LBF20207EO01
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8091 |
LipidMaps | - |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20207EO01.mol |
Structural Information | |
---|---|
Systematic Name | 7- [ 3,5-Epidioxy-2- (3-Hydroperoxy-1-Octenyl) Cycropentyl ] -5-Heptenoic Acid/7- [ 3,5-Epidioxy-2- (3-Hydroperoxy-1-Octenyl) Cycropentyl ] -5-Heptenoate |
Common Name | |
Symbol | |
Formula | C20H32O6 |
Exact Mass | 368.219888756 |
Average Mass | 368.46448 |
SMILES | C(CCC(OO)C=CC(C21)C(CC=CCCCC(O)=O)C(OO2)C1)CC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(Me-ester; after reduction and TMS)<<8080>>: m/e=569[M-CH3]; 513[M-(CH2)4CH3]; 494[M-HOTMS]; 404[M-2xHOTMS]; 378[494-SMTO=CHCH2]; 367[M-SMTOCH=CHCH=OTMS]; 191[SMTO=CHOTMS]; 173[SMTO=CH(CH2)4CH3]; GC-EI-MS(Me-ester; after reduction, hydrogenation and TMS) |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |