LBF18403SC05
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0210 |
| LipidMaps | LMFA01030171 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18403SC05.mol |
| beta-Parinaric acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | trans-9, trans-11, trans-13, trans-15-Octadecatetraenoic acid |
| Common Name |
|
| Symbol | |
| Formula | C18H28O2 |
| Exact Mass | 276.20893014 |
| Average Mass | 276.41372 |
| SMILES | CCC=CC=CC=CC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | 95 to 96 °C |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in ether and petroleum ether.<<0509>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
