LBF18305SC01
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0185 |
| LipidMaps | LMFA01030146 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18305SC01.mol |
| Punicic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | cis-9, trans-11, cis-13-Octadecatrienoic acid |
| Common Name |
|
| Symbol | |
| Formula | C18H30O2 |
| Exact Mass | 278.224580204 |
| Average Mass | 278.4296 |
| SMILES | CCCCC=CC=CC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | 43.5-44°C |
| Boiling Point | |
| Density | d504 0.9025 |
| Optical Rotation | 1.5113 at 50°C |
| Reflactive Index | |
| Solubility | soluble in ethanol, pentane and petroleum ether.<<0125>><<0128>><<0129>><<0130>><<0251>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
