LBF18302HP01
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8055 |
LipidMaps | LMFA01040039 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18302HP01.mol |
![]() | |
Structural Information | |
Systematic Name | Methyl-15-Hydroperoxy-9,12,16-Octadecatrienoate |
Common Name | |
Symbol | |
Formula | C19H32O4 |
Exact Mass | 324.23005951199997 |
Average Mass | 324.45498 |
SMILES | CC=CC(OO)CC=CCC=CCCCCCCCC(=O)OC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | EI-MS(Me-ester; after reduction and hydrogenation)<<8020>>: m/e=271[O=CH(CH2)13C(=OH)OCH3]; 242[CH2(CH2)12C(=OH)OCH3]; 239[O=CH(CH2)13C=O]; GC-EI-MS(Me-ester; after reduction and hydroganation)<<8090>>: m/e=143[SMTO=CH-CH=CH-CH3] |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |