LBF18206OX01
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8046 |
LipidMaps | LMFA01060071 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18206OX01.mol |
![]() | |
Structural Information | |
Systematic Name | 9-Oxo-10,12-Octadecadienoic Acid/9-Oxo-10,12-Octadecadienoate |
Common Name | |
Symbol | |
Formula | C18H30O3 |
Exact Mass | 294.21949482599996 |
Average Mass | 294.429 |
SMILES | CCCCCC=CC=CC(=O)CCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after methanolysis and hydrogenation)<<8056/8071/8012/8069>>: m/e=308[M], 277[M-OCH3], 237[M-(CH2)4CH3], 185[C(O)(CH2)6COOCH3], 166[CH3(CH2)4-CH=CH-CH=CH-C(OH)=CH2; Maclafferty transposition] 151[M-(CH2)7COOCH3]GC-EI-MS(TMS)<<8013>>: m/e=366[M], 341[M-CH3], 295[ [M-(CH2)4CH3], 276[M-HOTMS] |
UV Spectra | l MeOH /max=277-278nm(e=20300),lmax=267nm(cyclohexane)<<8013/8059/8056/8071>> |
IR Spectra | Trans, trans unsaturations(strong absorption at 1000-990cm-1), trans,cis unsaturations(960-955cm-1), unsaturated ketone(1695-1600cm-1) <<8013/8059/8056/8071/8069>> |
NMR Spectra | 1H-NMR<<8013/8071>>: C8(2.54ppm), C10, 12, 13(6.06-6.21ppm), C11(7.02-7.51ppm), C14(2.20-2.23ppm) |
Chromatograms |