LBF18203HP02
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8058 |
LipidMaps | LMFA01040042 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18203HP02.mol |
![]() | |
Structural Information | |
Systematic Name | Methyl-10,12-Epidioxy-13-Hydroperoxy-8,15-Octadecadienoate |
Common Name | |
Symbol | |
Formula | C19H32O6 |
Exact Mass | 356.219888756 |
Average Mass | 356.45378 |
SMILES | C(O1)(CC(C=CCCCCCCC(=O)OC)O1)C(OO)CC=CCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after reduction(PH3P) and TMS-derivatization)<<8084>>: m/e=307[M-CH3- HOTMS]; 241[M-171]; 171[SMTO=CHCH2CH=CHCH2CH3], GC-EI-MS(after reduction, hydrogenation, and tms-derivatization)<<8084>> |
UV Spectra | |
IR Spectra | OOH group: 3660-3150cm-1[bonded], 3520cm-1[free]; OLEFINIC PROTONS: 3020-3002cm-1; isolated trans unsaturation: 960cm-1<<8084>> |
NMR Spectra | 1H-NMR(105): C17[terminal methyl group attached ton the vinyl group]: 1.78ppm <<8084>> |
Chromatograms |