LBF18109HO04
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA8027 |
| LipidMaps | LMFA01050129 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18109HO04.mol |
| |
| Structural Information | |
| Systematic Name | 12,13-Dihydroxy-9-Octadecenoic Acid |
| Common Name | |
| Symbol | |
| Formula | C18H34O4 |
| Exact Mass | 314.24570957599997 |
| Average Mass | 314.46016 |
| SMILES | CCCCCC(O)C(O)CC=CCCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | GC-EI-MS(after methanolysis and trimethylsilylation)<<8059/8071>>: m/e=457[M-CH3], 441[M-OCH3], 382[M-HOTMS], 299[M-173], 275[SMTO=CH-CH(OTMS)-(CH2)4CH3], 185[275-HOTMS], 173[SMTO=CH-( CH2)4CH3],GC-EI-MS(after methanolysis, hydrogenation and trimethylsilylation)<<8059>> |
| UV Spectra | |
| IR Spectra | Methyl ester<<8071>> |
| NMR Spectra | |
| Chromatograms | |
