LBF18107HO03
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8026 |
LipidMaps | LMFA01050128 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18107HO03.mol |
Structural Information | |
---|---|
Systematic Name | 9,13-Dihydroxy-11-Octadecenoic Acid/9,13-Dihydroxy-11-Octadecenoate |
Common Name | |
Symbol | |
Formula | C18H34O4 |
Exact Mass | 314.24570957599997 |
Average Mass | 314.46016 |
SMILES | CCCCCC(O)C=CCC(O)CCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after methanolysis and trimethylsilylation)<<8059/8017/8012>>: m/e=429[M-43], 355, 259[SMTO=CH-CH(CH2)7 COOCH3], 199[CH=CH-CH(OTMS)-(CH2)4CH3], 173[SMTO=CH-(CH2)4CH3], GC-EI-MS(after methanolysis, hydrogenation and trimethylsilylation)<<8059/8092>> |
UV Spectra | |
IR Spectra | Trans unsaturation(980cm-1), olefinic(3010cm-1), OH(3620-3500cm-1)<<8017>> |
NMR Spectra | 1H-NMR(90MHz,CDCl3): trans olefinic protons(5.6-6.22ppm), carbinol methine protons(4.12ppm), J11-12=12.1Hz(trans unsaturation) <<8017>> |
Chromatograms |