LBF18107EO02
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8016 |
LipidMaps | LMFA01070005 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18107EO02.mol |
Structural Information | |
---|---|
Systematic Name | 9,10-Epoxy-13-Oxo-11-Octadecenoic Acid |
Common Name | |
Symbol | |
Formula | C18H30O4 |
Exact Mass | 310.21440944799997 |
Average Mass | 310.4284 |
SMILES | C(C(C=CC(=O)CCCCC)1)(CCCCCCCC(O)=O)O1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | GC-EI-MS(after methanolysis and trimethylsilylation )<<8013>>, GC-EIMS(after BF3-MeOH treatment and trimethylsilylation)(075/072): m/e=428[M], 413[M-CH3], 259[SMTO=CH(CH2)7- COOCH3], 242[CH3OCH-CH=CH-C(OTMS)(CH2)4CH3] |
UV Spectra | l ether/max=229-230nm; e=16500 (a,b-unsaturated carbonyl)<<8013/8056>> |
IR Spectra | Methyl ester: trans monoene(973cm-1), trans epoxide(885cm-1), cis epoxide(825 cm-1), conjugated carbonyl(1700, 1680, and 1635cm-1)<<8013>> |
NMR Spectra | 1H-NMR<<8013>>: C9(2.9ppm;trans epoxide), C10(3.20ppm; trans epoxide), C9(3.14ppm; cis-epoxide),C10(3.47ppm; cis epoxide), C11(6.57-6.63ppm), C12(6.34-6.36ppm), C14(2.52ppm), J9-10=2Hz(trans epoxide), J9-10=4Hz(cis epoxide), J11-12=16Hz(trans olefin) |
Chromatograms |