LBF18000OX06
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0449 |
| LipidMaps | LMFA01060065 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF18000OX06.mol |
| 9-Ketostearic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 9-Oxooctadecanoic acid |
| Common Name |
|
| Symbol | |
| Formula | C18H34O3 |
| Exact Mass | 298.25079495399996 |
| Average Mass | 298.46076 |
| SMILES | CCCCCCCCCC(=O)CCCCCCCC(O)=O |
| Physicochemical Information | |
| Melting Point | 83°C |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | easily soluble in acetic acid, ether and hot alcohol / insoluble in water <<0418>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
