LBF16000HO06
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA0349 |
| LipidMaps | LMFA01050083 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF16000HO06.mol |
| 3,12-dihydroxypalmitic acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,12-Dihydroxyhexadecanoic acid |
| Common Name |
|
| Symbol | |
| Formula | C16H32O4 |
| Exact Mass | 288.23005951199997 |
| Average Mass | 288.42287999999996 |
| SMILES | CCCCC(O)CCCCCCCCC(O)CC(O)=O |
| Physicochemical Information | |
| Melting Point | 83-84°C |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | soluble in methanol and alcohol<<0441>> |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
