FL5FEANS0017
From Metabolomics.JP
(Redirected from INCHI:SGCYGSKAUSOJND-UHFFFAOYSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FEA 6-Hydroxykaempferol and O-methyl derivatives (74 pages) : FL5FEANS Simple substitution (25 pages) : FL5FEANS0 Normal (20 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 4324-53-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FEANS0017.mol |
| 3,5-Dihydroxy-4',6,7-trimethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5-Dihydroxy-6,7-dimethoxy-2- (4-methoxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C18H16O7 |
| Exact Mass | 344.089602866 |
| Average Mass | 344.31543999999997 |
| SMILES | c(c1OC)c(O2)c(C(C(=C2c(c3)ccc(OC)c3)O)=O)c(c1OC)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
