FLND29NS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLN Neoflavonoid : FLND Dalbergione : FLND29 4,(3'),(5')-Hydroxydalbergione and O-methyl derivatives (1 pages) : FLND29NS Simple substitution (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 4646-86-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLND29NS0001.mol |
| (R) -4-Methoxydalbergione | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (R) -4-Methoxydalbergione |
| Common Name |
|
| Symbol | |
| Formula | C16H14O3 |
| Exact Mass | 254.094294314 |
| Average Mass | 254.28056 |
| SMILES | COc(c2)c(=O)cc(c(=O)2)[C@]([H])(C=C)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
