FLNB2CNS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLN Neoflavonoid : FLNB 4-Arylchroman : FLNB2C Brazilin and O-methyl derivatives (0 pages) : FLNB2CNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 474-07-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLNB2CNS0001.mol |
| Brazilin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (6aS) -6,6a,7,11bbeta-Tetrahydrobenzo [ b ] indeno [ 1,2-d ] pyran-3,6abeta,9,10-tetraol |
| Common Name |
|
| Symbol | |
| Formula | C16H14O5 |
| Exact Mass | 286.084123558 |
| Average Mass | 286.27936 |
| SMILES | Oc(c4)cc(O3)c(c4)C(c21)C(O)(C3)Cc(cc(O)c(O)c2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
