FLNAA9NP0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLN Neoflavonoid : FLNA 4-Arylcoumarin : FLNAA9 5,7,(3'),(5')-Trihydroxy-4-phenylcoumarin and O-methyl derivatives (20 pages) : FLNAA9NP Pyranoflavonoid (8 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 17312-31-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLNAA9NP0002.mol |
| Inophyllum E | |
|---|---|
| |
| Structural Information | |
| Systematic Name | rel- (10R*,11S*) -10,11-Dihydro-6,6,10,11-tetramethyl-4-phenyl-2H,6H,12H-benzo [ 1,2-b:3,4-b':5,6-b" ] tripyran-2,12-dione |
| Common Name |
|
| Symbol | |
| Formula | C25H22O5 |
| Exact Mass | 402.146723814 |
| Average Mass | 402.43918 |
| SMILES | O(C(C)5)c(c43)c(C(=O)C(C)5)c(O2)c(c3OC(C)(C)C=C4)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
