FLII1CNS0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLII 2-Arylbenzofuran : FLII1C 5,6,2',4'-Tetrahydroxy-2-phenylbenzofuran and O-methyl derivatives (4 pages) : FLII1CNS Simple substitution (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 67121-26-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLII1CNS0002.mol |
| 2',4'-Dihydroxy-5,6-methylenedioxy-2-phenylbenzofuran | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2',4'-Dihydroxy-5,6-methylenedioxy-2-phenylbenzofuran |
| Common Name |
|
| Symbol | |
| Formula | C15H10O5 |
| Exact Mass | 270.05282343 |
| Average Mass | 270.2369 |
| SMILES | Oc(c4)cc(O)c(c4)c(c1)oc(c2)c(cc(O3)c(OC3)2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
