FLIH1LNF0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIH 3-Arylcoumarin : FLIH1L (4),7,2',(3'),4',(5'),(6')-Hydroxy-3-phenylcoumarin and O-methyl derivatives (2 pages) : FLIH1LNF Furanoflavonoid (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 10091-01-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIH1LNF0001.mol |
| Neorautone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6- (6-Methoxy-1,3-benzodioxol-5-yl) -7H-furo [ 3,2-g ] [ 1 ] benzopyran-7-one |
| Common Name |
|
| Symbol | |
| Formula | C19H12O6 |
| Exact Mass | 336.063388116 |
| Average Mass | 336.29498 |
| SMILES | c(c45)c(c(OC)cc4OCO5)C(=C3)C(=O)Oc(c32)cc(c1c2)occ |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
