FLIBALNI0006
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIB Isoflavanone : FLIBAL 5,7,2',(3'),4',(5'),(6')-Trihydroxyisoflavanone and O-methyl derivatives (28 pages) : FLIBALNI Non-cyclic prenyl substituted (11 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 88899-18-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIBALNI0006.mol |
| Diphysolone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,2',4'-Tetrahydroxy-6-prenylisoflavanone |
| Common Name |
|
| Symbol | |
| Formula | C20H20O6 |
| Exact Mass | 356.125988372 |
| Average Mass | 356.3692 |
| SMILES | C(c(c(O)1)c(O)cc(O2)c1C(C(c(c3)c(O)cc(O)c3)C2)=O)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
