FLIB1CNS0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIB Isoflavanone : FLIB1C 7,3',4'-Trihydroxyisoflavanone and O-methyl derivatives (1 pages) : FLIB1CNS Simple substitution (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 83206-83-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIB1CNS0002.mol |
| 3'-Methoxydihydroformononetin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7-Hydroxy-3',4'-dimethoxyisoflavanone |
| Common Name |
|
| Symbol | |
| Formula | C17H16O5 |
| Exact Mass | 300.099773622 |
| Average Mass | 300.30593999999996 |
| SMILES | COc(c3)c(OC)cc(c3)C(C1)C(=O)c(c2)c(cc(O)c2)O1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
