FLIAEGNS0004
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIAEG 5,6,7,3',4',5'-Hexamethoxyisoflavone and O-methyl derivatives (5 pages) : FLIAEGNS Simple substitution (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 88509-91-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAEGNS0004.mol |
| 5,3'-Dihydroxy-4',5'-dimethoxy-6,7-methylenedioxyisoflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,3'-Dihydroxy-4',5'-dimethoxy-6,7-methylenedioxyisoflavone |
| Common Name |
|
| Symbol | |
| Formula | C18H14O8 |
| Exact Mass | 358.068867424 |
| Average Mass | 358.29896 |
| SMILES | c(c34)c(c1c(c3OCO4)O)OC=C(c(c2)cc(c(OC)c(O)2)OC)C1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
