FLIA3CNS0006
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIA3C 7,8,3',4'-Tetramethoxyisoflavone and O-methyl derivatives (7 pages) : FLIA3CNS Simple substitution (6 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 117634-59-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIA3CNS0006.mol |
| 7,8,3'-Trihydroxy-4'-methoxyisoflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7,8,3'-Trihydroxy-4'-methoxyisoflavone |
| Common Name |
|
| Symbol | |
| Formula | C16H12O6 |
| Exact Mass | 300.063388116 |
| Average Mass | 300.26288 |
| SMILES | COc(c3)c(O)cc(c3)C(=C2)C(=O)c(c1)c(O2)c(O)c(O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
