FLIA1LNF0001
From Metabolomics.JP
				
								
				
				
																
				
				
								
				
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIA1L 7,2',(3'),4',(5'),(6')-Hydroxyisoflavone and O-methyl derivatives (28 pages) : FLIA1LNF Furanoflavonoid (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 1242-81-5 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FLIA1LNF0001.mol | 
| Dehydroneotenone | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 6- (6-Methoxy-1,3-benzodioxol-5-yl) -5H-furo [ 3,2-g ] [ 1 ] benzopyran-5-one | 
| Common Name | 
  | 
| Symbol | |
| Formula | C19H12O6 | 
| Exact Mass | 336.063388116 | 
| Average Mass | 336.29498 | 
| SMILES | c(c45)c(c(OC)cc4OCO5)C(C3=O)=COc(c32)cc(c1c2)occ1 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
  | 
