FL63AJNS0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL63 Flavan 3-ol : FL63AJ Gallocatechin 4'-methyl ether and Epigallocatechin 4'-methyl ehter (2 pages) : FL63AJNS Simple substitution (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 17291-05-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL63AJNS0002.mol |
| Ourateacatechin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R) -2alpha- (3,5-Dihydroxy-4-methoxyphenyl) -3,4-dihydro-2H-1-benzopyran-3alpha,5,7-triol |
| Common Name |
|
| Symbol | |
| Formula | C16H16O7 |
| Exact Mass | 320.089602866 |
| Average Mass | 320.29404 |
| SMILES | COc(c(O)3)c(O)cc(c3)C(O1)C(O)Cc(c(O)2)c(cc(O)c2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
