FL63AGNS0018
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL63 Flavan 3-ol : FL63AG Gallocatechin and Epigallocatechin (23 pages) : FL63AGNS Simple substitution (17 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 4233-96-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL63AGNS0018.mol |
| (-)-Gallocatechin 3-gallate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2S)-3,4-Dihydro-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3,5,7-triol 3-(3,4,5-trihydroxybenzoate) |
| Common Name |
|
| Symbol | |
| Formula | C22H18O11 |
| Exact Mass | 458.084911418 |
| Average Mass | 458.37172000000004 |
| SMILES | Oc(c4)cc(O1)c(c(O)4)CC(OC(=O)c(c3)cc(O)c(O)c(O)3)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
