FL5FFANS0010
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FFA Herbacetin and O-methyl derivatives (70 pages) : FL5FFANS Simple substitution (24 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 70703-48-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FFANS0010.mol |
| Herbacetin 7,4'-dimethyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,8-Trihydroxy-7,4'-dimethoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C17H14O7 |
| Exact Mass | 330.073952802 |
| Average Mass | 330.28886 |
| SMILES | COc(c3)ccc(c3)C(O1)=C(O)C(=O)c(c(O)2)c1c(O)c(OC)c2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
