FL5F3CNS0006
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5F3C Melanoxetin and O-methyl derivatives (5 pages) : FL5F3CNS Simple substitution (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 63807-91-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5F3CNS0006.mol |
| 3'-O-Methylmelanoxetin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,7,8-Trihydroxy-2- (4-hydroxy-3-methoxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C16H12O7 |
| Exact Mass | 316.058302738 |
| Average Mass | 316.26228000000003 |
| SMILES | COc(c(O)3)cc(cc3)C(O1)=C(O)C(=O)c(c2)c1c(O)c(O)c2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
