FL3FRNND0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FRN Flavone include extra rings (27 pages) : FL3FRNND Furano and pyrano substituted (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 121748-26-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FRNND0001.mol |
| Cycloartobiloxanthone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5a,6-Dihydro-1,3,8-trihydroxy-5,5,11,11-tetramethyl-5H,7H,11H-benzofuro [ 3,4-bc ] pyrano [ 3,2-h ] xanthen-7-one |
| Common Name |
|
| Symbol | |
| Formula | C25H22O7 |
| Exact Mass | 434.136553058 |
| Average Mass | 434.43798000000004 |
| SMILES | O(c45)C(c32)=C(C(=O)c(c(cc(O6)c(C=CC6(C)C)5)O)4)CC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
