FL3FGCNS0013
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FGC 5,6,7,8,3',4'-Hexahydroxyflavone and O-methyl derivatives (31 pages) : FL3FGCNS Simple substitution (18 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | - |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FGCNS0013.mol |
| Linderoflavone A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-6,8-dimethoxyflavone-3',4'-methylenedioxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C18H14O8 |
| Exact Mass | 358.068867424 |
| Average Mass | 358.29896 |
| SMILES | c(c41)(OCO4)ccc(C(O2)=CC(c(c3O)c2c(c(c3OC)O)OC)=O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
