FL3FGANS0009
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FGA 5,6,7,8,4'-Pentahydroxyflavone and O-methyl derivatives (20 pages) : FL3FGANS Simple substitution (14 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 73213-66-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FGANS0009.mol |
| 7-Hydroxy-5,6,8,4'-tetramethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7-Hydroxy-5,6,8,4'-tetramethoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C19H18O7 |
| Exact Mass | 358.10525293 |
| Average Mass | 358.34202000000005 |
| SMILES | c(C(O2)=CC(c(c3OC)c2c(c(c3OC)O)OC)=O)(c1)ccc(OC)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
