FL3FEGNS0013
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FEG 6-Hydroxytricetin and O-methyl derivatives (20 pages) : FL3FEGNS Simple substitution (13 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 178330-71-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FEGNS0013.mol |
| 5,3',5'-Trihydroxy-6,7,4'-trimethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (3,5-Dihydroxy-4-methoxyphenyl) -5-hydroxy-6,7-dimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C18H16O8 |
| Exact Mass | 360.08451748799996 |
| Average Mass | 360.31484 |
| SMILES | c(OC)(c(O)1)c(O)cc(C(O2)=CC(c(c3O)c2cc(c3OC)OC)=O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
