FL2FG9NS0003
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FG9 5,6,7,8,(3'),(5')-Hydroxyflavanone and O-methyl derivatives (5 pages) : FL2FG9NS Simple substitution (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 75428-50-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FG9NS0003.mol |
| 5-Hydroxy-6,7,8-trimethoxyflavanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Hydroxy-6,7,8-trimethoxyflavanone |
| Common Name |
|
| Symbol | |
| Formula | C18H18O6 |
| Exact Mass | 330.110338308 |
| Average Mass | 330.33191999999997 |
| SMILES | O(C2c(c3)cccc3)c(c1OC)c(C(=O)C2)c(c(c1OC)OC)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
