FL2FFCNS0004
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FFC 8-Hydroxyeriodictol and O-methyl derivatives (3 pages) : FL2FFCNS Simple substitution (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 460090-60-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FFCNS0004.mol |
| 8-Hydroxyhesperetin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,8,3'-Tetrahydroxy-4'-methoxyflavanone |
| Common Name |
|
| Symbol | |
| Formula | C16H14O7 |
| Exact Mass | 318.073952802 |
| Average Mass | 318.27816 |
| SMILES | COc(c3)c(O)cc(c3)C(C1)Oc(c(O)2)c(c(O)cc(O)2)C(=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
