FL2FA9NI0015
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FA9 5,7,(3'),(5')-Hydroxyflavanone and O-methyl derivatives (90 pages) : FL2FA9NI Non-cyclic prenyl substituted (22 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 94393-10-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FA9NI0015.mol |
| 7-O-Prenylpinocembrin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (S) -2,3-Dihydro-5-hydroxy-7- (prenyloxy) -2-phenyl-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C20H20O4 |
| Exact Mass | 324.136159128 |
| Average Mass | 324.37039999999996 |
| SMILES | C(C1)(c(c3)cccc3)Oc(c2)c(c(cc2OCC=C(C)C)O)C(=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
