FL2F19NP0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2F19 7,(3'),(5')-Hydroxyflavanone and O-methyl derivatives (14 pages) : FL2F19NP Pyranoflavonoid (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 102673-83-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2F19NP0002.mol |
| 8-C-Prenyl-6",6"-dimethylpyrano [ 2",3":7,6 ] flavanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 8-C-Prenyl-6",6"-dimethylpyrano [ 2",3":7,6 ] flavanone |
| Common Name |
|
| Symbol | |
| Formula | C25H26O3 |
| Exact Mass | 374.18819469799996 |
| Average Mass | 374.47213999999997 |
| SMILES | C(c(c43)c(O1)c(cc3C=CC(C)(C)O4)C(=O)CC1c(c2)cccc2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
