FL1DQUNM0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1D Dihydrochalcone : FL1DQU Dihydroflavonol quinone (7 pages) : FL1DQUNM C-Methyl or C2/C3 substituted (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 50861-53-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1DQUNM0002.mol |
| Grandiflorone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2,2,4,4-Tetramethyl-6- (1-oxo-3-phenylpropyl) -1,3,5-cyclohexanetrione |
| Common Name |
|
| Symbol | |
| Formula | C19H22O4 |
| Exact Mass | 314.151809192 |
| Average Mass | 314.37558 |
| SMILES | C(C(=C2O)C(C(C(C2(C)C)=O)(C)C)=O)(=O)CCc(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
