FL1DHXNS0003
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1D Dihydrochalcone : FL1DHX alpha-Hydroxydihydroflavonol (14 pages) : FL1DHXNS Simple substitution (7 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 88126-55-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1DHXNS0003.mol |
| 4,2',4',alpha-Tetrahydroxydihydrochalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 4,2',4',alpha-Tetrahydroxydihydrochalcone |
| Common Name |
|
| Symbol | |
| Formula | C15H14O5 |
| Exact Mass | 274.084123558 |
| Average Mass | 274.26866 |
| SMILES | Oc(c2)ccc(c2)CC(O)C(=O)c(c1)c(O)cc(O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
