FL1DCANS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1D Dihydrochalcone : FL1DCA Asebogenin (3 pages) : FL1DCANS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 520-42-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1DCANS0001.mol |
| Asebogenin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 1- (2,6-Dihydroxy-4-methoxyphenyl) -3- (4-hydroxyphenyl) -1-propanone |
| Common Name |
|
| Symbol | |
| Formula | C16H16O5 |
| Exact Mass | 288.099773622 |
| Average Mass | 288.29524 |
| SMILES | COc(c1)cc(O)c(C(=O)CCc(c2)ccc(O)c2)c(O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
