FL1DAANN0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1D Dihydrochalcone : FL1DAA Phloretin (11 pages) : FL1DAANN Flavonophenylpropanoid (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 137319-45-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1DAANN0001.mol |
| Calomelanol B | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,4-Dihydro-5,7-dihydroxy-4-phenyl-8- [ 3- (4-hydroxyphenyl) -1-oxopropyl ] -2H-1-benzopyran-2-one |
| Common Name |
|
| Symbol | |
| Formula | C24H20O6 |
| Exact Mass | 404.125988372 |
| Average Mass | 404.412 |
| SMILES | C(CC(c(c32)c(cc(c(C(c(c4)cccc4)CC(=O)O3)2)O)O)=O)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
