FL1D99NS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1D Dihydrochalcone : FL1D99 (3),(5),(2'),(3'),(5'),(6')-Hydroxydihydrochalcone and O-methyl derivatives (0 pages) : FL1D99NS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 1083-30-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1D99NS0001.mol |
| Dihydrochalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 1,3-Diphenylpropan-1-one |
| Common Name |
|
| Symbol | |
| Formula | C15H14O |
| Exact Mass | 210.10446507 |
| Average Mass | 210.27106000000003 |
| SMILES | O=C(CCc(c2)cccc2)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
