FL1CHYNM0003
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CHY beta-Hydroxychalcone (36 pages) : FL1CHYNM C-Methyl or C2/C3 substituted (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 87247-97-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CHYNM0003.mol |
| Tinosporinone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 1- (2',4'-Dimethoxyphenyl) -3- (3",4"-methylenedioxyphenyl) -2-methylpropan-1,3-dione |
| Common Name |
|
| Symbol | |
| Formula | C19H18O6 |
| Exact Mass | 342.110338308 |
| Average Mass | 342.34262 |
| SMILES | c(c31)(OCO3)ccc(C(C(C(c(c(OC)2)ccc(OC)c2)=O)C)=O)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
