FL1C99NS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C99 4'-Desoxychalcone (2,4-Desoxy) and O-methyl derivatives (2 pages) : FL1C99NS Simple substitution (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 22966-19-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C99NS0001.mol |
| 4'-Methoxychalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 4'-Methoxychalcone |
| Common Name |
|
| Symbol | |
| Formula | C16H14O2 |
| Exact Mass | 238.09937969199999 |
| Average Mass | 238.28116 |
| SMILES | COc(c2)ccc(c2)C(=O)C=Cc(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
