FL1C2CNS0002
From Metabolomics.JP
				
								
				
				
																
				
				
								
				
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C2C Neoplathymenin and O-methyl derivatives (4 pages) : FL1C2CNS Simple substitution (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 70981-47-4 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C2CNS0002.mol | 
| Prosogerin B | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 2',4'-Dihydroxy-5'-methoxy-3,4-methylenedioxychalcone | 
| Common Name | 
  | 
| Symbol | |
| Formula | C17H14O6 | 
| Exact Mass | 314.07903818 | 
| Average Mass | 314.28945999999996 | 
| SMILES | COc(c1)c(O)cc(O)c1C(=O)C=Cc(c2)cc(O3)c(OC3)c2 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
  | 
