FL1C1ANI0016
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C1A Isoliquiritigenin and O-methyl derivatives (81 pages) : FL1C1ANI Non-cyclic prenyl substituted (33 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 62949-76-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C1ANI0016.mol |
| Xanthoangelol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (E) -1- [ 3- [ (E) -3,7-Dimethyl-2,6-octadienyl ] -2,4-dihydroxyphenyl ] -3- (4-hydroxyphenyl) -2-propen-1-one |
| Common Name |
|
| Symbol | |
| Formula | C25H28O4 |
| Exact Mass | 392.19875938399997 |
| Average Mass | 392.48742 |
| SMILES | C(=O)(C=Cc(c2)ccc(O)c2)c(c(O)1)ccc(O)c1CC=C(C)CCC= |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
