FL1C1ANI0006
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C1A Isoliquiritigenin and O-methyl derivatives (81 pages) : FL1C1ANI Non-cyclic prenyl substituted (33 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 132998-84-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C1ANI0006.mol |
| Xanthoangelol E | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (E) -1- [ 2-Hydroxy-4-methoxy-3- (2-hydroperoxy-3-methyl-3-butenyl) phenyl ] -3- (4-hydroxyphenyl) -2-propen-1-one |
| Common Name |
|
| Symbol | |
| Formula | C21H22O6 |
| Exact Mass | 370.141638436 |
| Average Mass | 370.39578 |
| SMILES | Oc(c2)ccc(c2)C=CC(c(c1O)ccc(c1CC(OO)C(C)=C)OC)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
