FL1C19NI0003
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C19 (3),(5),2',4'-Hydroxychalcone and O-methyl derivatives (16 pages) : FL1C19NI Non-cyclic prenyl substituted (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 38965-77-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C19NI0003.mol |
| Derricin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (E) -1- [ 2-Hydroxy-4-methoxy-3- (3-methyl-2-butenyl) phenyl ] -3-phenyl-2-propen-1-one |
| Common Name |
|
| Symbol | |
| Formula | C21H22O3 |
| Exact Mass | 322.15689456999996 |
| Average Mass | 322.39758 |
| SMILES | C(c(c1O)c(ccc1C(=O)C=Cc(c2)cccc2)OC)C=C(C)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
